C15H12BrFN2O4 — CID 27693652
N'-[2-(4-bromo-2-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide (PubChem CID 27693652) has the molecular formula C15H12BrFN2O4 and a molecular weight of 383.17 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 27693652 |
| Molecular Formula | C15H12BrFN2O4 |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | N'-[2-(4-bromo-2-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(COc1ccc(Br)cc1F)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H12BrFN2O4/c16-9-5-6-13(11(17)7-9)23-8-14(21)18-19-15(22)10-3-1-2-4-12(10)20/h1-7,20H,8H2,(H,18,21)(H,19,22) |
| InChIKey | ZKYTXTYQKVRSAA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|