C15H12ClFN2O4 — CID 27698260
N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide (PubChem CID 27698260) has the molecular formula C15H12ClFN2O4 and a molecular weight of 338.72 g/mol. Its IUPAC name is N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 27698260 |
| Molecular Formula | C15H12ClFN2O4 |
| Molecular Weight | 338.72 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(COc1ccc(F)cc1Cl)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H12ClFN2O4/c16-11-7-9(17)5-6-13(11)23-8-14(21)18-19-15(22)10-3-1-2-4-12(10)20/h1-7,20H,8H2,(H,18,21)(H,19,22) |
| InChIKey | NANMSBCBWXOTIZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|