C16H12ClF3N2O4 — CID 55628971
5-chloro-2-hydroxy-N'-[2-[2-(trifluoromethyl)phenoxy]acetyl]benzohydrazide (PubChem CID 55628971) has the molecular formula C16H12ClF3N2O4 and a molecular weight of 388.73 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N'-[2-[2-(trifluoromethyl)phenoxy]acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-hydroxy-N'-[2-[2-(trifluoromethyl)phenoxy]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55628971 |
| Molecular Formula | C16H12ClF3N2O4 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-chloro-2-hydroxy-N'-[2-[2-(trifluoromethyl)phenoxy]acetyl]benzohydrazide |
| SMILES | O=C(COc1ccccc1C(F)(F)F)NNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H12ClF3N2O4/c17-9-5-6-12(23)10(7-9)15(25)22-21-14(24)8-26-13-4-2-1-3-11(13)16(18,19)20/h1-7,23H,8H2,(H,21,24)(H,22,25) |
| InChIKey | FBBDYFYJPZXBIX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|