C12H21NO2 — CID 23550172
1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)prop-2-yn-1-ol (PubChem CID 23550172) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)prop-2-yn-1-ol.
| Compound Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 23550172 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C12H21NO2/c1-6-10(14)9-7-11(2,3)13(15)12(4,5)8-9/h1,9-10,14-15H,7-8H2,2-5H3 |
| InChIKey | KZSOPUXNJGAGLZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|