C18H37N3O3 — CID 173258983
1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 173258983) has the molecular formula C18H37N3O3 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 173258983 |
| Molecular Formula | C18H37N3O3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(NC2(O)CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C18H37N3O3/c1-14(2)9-13(10-15(3,4)20(14)23)19-18(22)11-16(5,6)21(24)17(7,8)12-18/h13,19,22-24H,9-12H2,1-8H3 |
| InChIKey | GBOLBDGBIPYHKY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|