C9H20N2O2 — CID 91600427
4-amino-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 91600427) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-amino-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 4-amino-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 91600427 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 4-amino-1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(N)(O)CC(C)(C)N1O |
| InChI | InChI=1S/C9H20N2O2/c1-7(2)5-9(10,12)6-8(3,4)11(7)13/h12-13H,5-6,10H2,1-4H3 |
| InChIKey | HXTMTRMZPRCOKU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|