C13H29N3O2 — CID 159092415
1-hydroxypiperazine;1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 159092415) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-hydroxypiperazine;1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxypiperazine;1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 159092415 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-hydroxypiperazine;1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1O.ON1CCNCC1 |
| InChI | InChI=1S/C9H19NO.C4H10N2O/c1-8(2)6-5-7-9(3,4)10(8)11;7-6-3-1-5-2-4-6/h11H,5-7H2,1-4H3;5,7H,1-4H2 |
| InChIKey | KCFQLGSQDROYTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |