C13H25NO3 — CID 132889909
1-hydroxy-2,2,6,6-tetramethylpiperidine;2-methylprop-2-enoic acid (PubChem CID 132889909) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidine;2-methylprop-2-enoic acid.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 132889909 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC1(C)CCCC(C)(C)N1O |
| InChI | InChI=1S/C9H19NO.C4H6O2/c1-8(2)6-5-7-9(3,4)10(8)11;1-3(2)4(5)6/h11H,5-7H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | SCXWBFSTWJHYDA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|