C11H22N2O2 — CID 161040368
1-hydroxy-2,2,6,6-tetramethylpiperidine;methylimino(oxo)methane (PubChem CID 161040368) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidine;methylimino(oxo)methane.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;methylimino(oxo)methane |
|---|---|
| PubChem CID | 161040368 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;methylimino(oxo)methane |
| SMILES | CC1(C)CCCC(C)(C)N1O.CN=C=O |
| InChI | InChI=1S/C9H19NO.C2H3NO/c1-8(2)6-5-7-9(3,4)10(8)11;1-3-2-4/h11H,5-7H2,1-4H3;1H3 |
| InChIKey | CSPRMCUVKKDRJY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|