C10H20N4O2S — CID 154502715
1-sulfonyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine (PubChem CID 154502715) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-sulfonyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine.
| Compound Name | 1-sulfonyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine |
|---|---|
| PubChem CID | 154502715 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-sulfonyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine |
| SMILES | CC1(C)CCCC(C)(C)N1N=C(N)N=S(=O)=O |
| InChI | InChI=1S/C10H20N4O2S/c1-9(2)6-5-7-10(3,4)14(9)12-8(11)13-17(15)16/h5-7H2,1-4H3,(H2,11,12) |
| InChIKey | ZCPZSKUYVLVOTO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|