C22H40N2O2 — CID 90092167
1,4-bis(2,2,6,6-tetramethylpiperidin-1-yl)butane-1,4-dione (PubChem CID 90092167) has the molecular formula C22H40N2O2 and a molecular weight of 364.57 g/mol. Its IUPAC name is 1,4-bis(2,2,6,6-tetramethylpiperidin-1-yl)butane-1,4-dione.
| Compound Name | 1,4-bis(2,2,6,6-tetramethylpiperidin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90092167 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1,4-bis(2,2,6,6-tetramethylpiperidin-1-yl)butane-1,4-dione |
| SMILES | CC1(C)CCCC(C)(C)N1C(=O)CCC(=O)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C22H40N2O2/c1-19(2)13-9-14-20(3,4)23(19)17(25)11-12-18(26)24-21(5,6)15-10-16-22(24,7)8/h9-16H2,1-8H3 |
| InChIKey | WCUNSIVCTGBWKY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |