C10H20LiN2O — CID 66782891
CID 66782891 (PubChem CID 66782891) has the molecular formula C10H20LiN2O and a molecular weight of 191.22 g/mol.
| Compound Name | CID 66782891 |
|---|---|
| PubChem CID | 66782891 |
| Molecular Formula | C10H20LiN2O |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | — |
| SMILES | CC1(C)CCCC(C)(C)N1C(N)=O.[Li] |
| InChI | InChI=1S/C10H20N2O.Li/c1-9(2)6-5-7-10(3,4)12(9)8(11)13;/h5-7H2,1-4H3,(H2,11,13); |
| InChIKey | SZYXHZQXAKTFIU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |