About CID 66782891
CID 66782891 (PubChem CID 66782891) has the molecular formula C10H20LiN2O
and a molecular weight of 191.22 g/mol.
Molecular Properties
| Compound Name | CID 66782891 |
| PubChem CID | 66782891 |
| Molecular Formula | C10H20LiN2O |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | — |
| SMILES | CC1(C)CCCC(C)(C)N1C(N)=O.[Li] |
| InChI | InChI=1S/C10H20N2O.Li/c1-9(2)6-5-7-10(3,4)12(9)8(11)13;/h5-7H2,1-4H3,(H2,11,13); |
| InChIKey | SZYXHZQXAKTFIU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 66782891 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66782891?
The IUPAC name of CID 66782891 (CID 66782891) is not available.
What is the SMILES notation for CID 66782891?
The canonical SMILES for CID 66782891 is CC1(C)CCCC(C)(C)N1C(N)=O.[Li].
What is the InChIKey of CID 66782891?
The InChIKey is SZYXHZQXAKTFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.Li/c1-9(2)6-5-7-10(3,4)12(9)8(11)13;/h5-7H2,1-4H3,(H2,11,13);.
What are the key properties of CID 66782891?
CID 66782891 has a molecular weight of 191.22 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66782891 is sourced from PubChem (CID 66782891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).