C24H50N2O4 — CID 139091090
2-(2,2,6,6-tetramethylpiperidin-1-yl)propane-1,3-diol (PubChem CID 139091090) has the molecular formula C24H50N2O4 and a molecular weight of 430.67 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-1-yl)propane-1,3-diol.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-1-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 139091090 |
| Molecular Formula | C24H50N2O4 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-1-yl)propane-1,3-diol |
| SMILES | CC1(C)CCCC(C)(C)N1C(CO)CO.CC1(C)CCCC(C)(C)N1C(CO)CO |
| InChI | InChI=1S/2C12H25NO2/c2*1-11(2)6-5-7-12(3,4)13(11)10(8-14)9-15/h2*10,14-15H,5-9H2,1-4H3 |
| InChIKey | NOSAKBRZBXTNFY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |