C18H39N3 — CID 70412758
1-ethyl-1-[2-(2,2,6,6-tetramethylpiperidin-1-yl)heptyl]hydrazine (PubChem CID 70412758) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 1-ethyl-1-[2-(2,2,6,6-tetramethylpiperidin-1-yl)heptyl]hydrazine.
| Compound Name | 1-ethyl-1-[2-(2,2,6,6-tetramethylpiperidin-1-yl)heptyl]hydrazine |
|---|---|
| PubChem CID | 70412758 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 1-ethyl-1-[2-(2,2,6,6-tetramethylpiperidin-1-yl)heptyl]hydrazine |
| SMILES | CCCCCC(CN(N)CC)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C18H39N3/c1-7-9-10-12-16(15-20(19)8-2)21-17(3,4)13-11-14-18(21,5)6/h16H,7-15,19H2,1-6H3 |
| InChIKey | IAHVMVYOAVKNBZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|