C15H28N2 — CID 71399011
N-(2,2,6,6-tetramethylpiperidin-1-yl)cyclohexanimine (PubChem CID 71399011) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-1-yl)cyclohexanimine.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-1-yl)cyclohexanimine |
|---|---|
| PubChem CID | 71399011 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-1-yl)cyclohexanimine |
| SMILES | CC1(C)CCCC(C)(C)N1N=C1CCCCC1 |
| InChI | InChI=1S/C15H28N2/c1-14(2)11-8-12-15(3,4)17(14)16-13-9-6-5-7-10-13/h5-12H2,1-4H3 |
| InChIKey | MFKYDWYQPQMCDF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|