C8H10N2O2 — CID 20575619
1,1-bis(isocyanatomethyl)cyclobutane (PubChem CID 20575619) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,1-bis(isocyanatomethyl)cyclobutane.
| Compound Name | 1,1-bis(isocyanatomethyl)cyclobutane |
|---|---|
| PubChem CID | 20575619 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1,1-bis(isocyanatomethyl)cyclobutane |
| SMILES | O=C=NCC1(CN=C=O)CCC1 |
| InChI | InChI=1S/C8H10N2O2/c11-6-9-4-8(2-1-3-8)5-10-7-12/h1-5H2 |
| InChIKey | MZLFZARIWXUTLX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|