C17H23NO3 — CID 87059240
acetic acid;[1-(isocyanatomethyl)cyclohexyl]methylbenzene (PubChem CID 87059240) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is acetic acid;[1-(isocyanatomethyl)cyclohexyl]methylbenzene.
| Compound Name | acetic acid;[1-(isocyanatomethyl)cyclohexyl]methylbenzene |
|---|---|
| PubChem CID | 87059240 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | acetic acid;[1-(isocyanatomethyl)cyclohexyl]methylbenzene |
| SMILES | CC(=O)O.O=C=NCC1(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C15H19NO.C2H4O2/c17-13-16-12-15(9-5-2-6-10-15)11-14-7-3-1-4-8-14;1-2(3)4/h1,3-4,7-8H,2,5-6,9-12H2;1H3,(H,3,4) |
| InChIKey | BEZXTYCXJOCQGS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|