C24H37NO6 — CID 67499498
acetic acid;1-[(1-benzylcyclohexyl)methylcarbamoyloxy]butyl propanoate (PubChem CID 67499498) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is acetic acid;1-[(1-benzylcyclohexyl)methylcarbamoyloxy]butyl propanoate.
| Compound Name | acetic acid;1-[(1-benzylcyclohexyl)methylcarbamoyloxy]butyl propanoate |
|---|---|
| PubChem CID | 67499498 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | acetic acid;1-[(1-benzylcyclohexyl)methylcarbamoyloxy]butyl propanoate |
| SMILES | CC(=O)O.CCCC(OC(=O)CC)OC(=O)NCC1(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H33NO4.C2H4O2/c1-3-11-20(26-19(24)4-2)27-21(25)23-17-22(14-9-6-10-15-22)16-18-12-7-5-8-13-18;1-2(3)4/h5,7-8,12-13,20H,3-4,6,9-11,14-17H2,1-2H3,(H,23,25);1H3,(H,3,4) |
| InChIKey | WJSLIJXYSBGONK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|