C15H22N2O2 — CID 163807414
(1E)-3,7-bis(isocyanatomethyl)-3,7-dimethylcyclononene (PubChem CID 163807414) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1E)-3,7-bis(isocyanatomethyl)-3,7-dimethylcyclononene.
| Compound Name | (1E)-3,7-bis(isocyanatomethyl)-3,7-dimethylcyclononene |
|---|---|
| PubChem CID | 163807414 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1E)-3,7-bis(isocyanatomethyl)-3,7-dimethylcyclononene |
| SMILES | CC1(CN=C=O)/C=C/CCC(C)(CN=C=O)CCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-14(10-16-12-18)6-3-4-7-15(2,9-5-8-14)11-17-13-19/h3,6H,4-5,7-11H2,1-2H3/b6-3+ |
| InChIKey | NKFKJJOFDWFLIN-ZZXKWVIFSA-N |
| XLogP | 3.19 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|