C13H20N2O2 — CID 21323851
1,5-bis(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 21323851) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1,5-bis(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
| Compound Name | 1,5-bis(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 21323851 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1,5-bis(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC1(C)CC(CN=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C13H20N2O2/c1-12(2)4-11(6-14-9-16)5-13(3,7-12)8-15-10-17/h11H,4-8H2,1-3H3 |
| InChIKey | JSQXPOMJGAJLIP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|