C13H18N2O2 — CID 157356904
5,6-bis(isocyanatomethyl)-3,3,5-trimethylcyclohexene (PubChem CID 157356904) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5,6-bis(isocyanatomethyl)-3,3,5-trimethylcyclohexene.
| Compound Name | 5,6-bis(isocyanatomethyl)-3,3,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 157356904 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5,6-bis(isocyanatomethyl)-3,3,5-trimethylcyclohexene |
| SMILES | CC1(C)C=CC(CN=C=O)C(C)(CN=C=O)C1 |
| InChI | InChI=1S/C13H18N2O2/c1-12(2)5-4-11(6-14-9-16)13(3,7-12)8-15-10-17/h4-5,11H,6-8H2,1-3H3 |
| InChIKey | BIEQIJKAORSVCZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|