About cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane
cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane (PubChem CID 87845812) has the molecular formula C20H28N4O4
and a molecular weight of 388.47 g/mol. Its IUPAC name is cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane.
Molecular Properties
| Compound Name | cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane |
| PubChem CID | 87845812 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane |
| SMILES | C1CCCCC1.O=C=NCC1(CN=C=O)CCCC(CN=C=O)(CN=C=O)C1 |
| InChI | InChI=1S/C14H16N4O4.C6H12/c19-9-15-5-13(6-16-10-20)2-1-3-14(4-13,7-17-11-21)8-18-12-22;1-2-4-6-5-3-1/h1-8H2;1-6H2 |
| InChIKey | BUXVHTCVVIATRJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane?
The IUPAC name of cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane (CID 87845812) is cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane.
What is the SMILES notation for cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane?
The canonical SMILES for cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane is C1CCCCC1.O=C=NCC1(CN=C=O)CCCC(CN=C=O)(CN=C=O)C1.
What is the InChIKey of cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane?
The InChIKey is BUXVHTCVVIATRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O4.C6H12/c19-9-15-5-13(6-16-10-20)2-1-3-14(4-13,7-17-11-21)8-18-12-22;1-2-4-6-5-3-1/h1-8H2;1-6H2.
What are the key properties of cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane?
cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane has a molecular weight of 388.47 g/mol, XLogP of 3.22, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;1,1,3,3-tetrakis(isocyanatomethyl)cyclohexane is sourced from PubChem (CID 87845812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).