C17H33NO4 — CID 135359248
tert-butyl 2-methylprop-2-enoate;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 135359248) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-enoate;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | tert-butyl 2-methylprop-2-enoate;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 135359248 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | tert-butyl 2-methylprop-2-enoate;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | C=C(C)C(=O)OC(C)(C)C.CC1(C)CC(O)CC(C)(C)N1O |
| InChI | InChI=1S/C9H19NO2.C8H14O2/c1-8(2)5-7(11)6-9(3,4)10(8)12;1-6(2)7(9)10-8(3,4)5/h7,11-12H,5-6H2,1-4H3;1H2,2-5H3 |
| InChIKey | NWGKBWMJHKJZIF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|