C12H18F2O2 — CID 155355016
2-(3,3-difluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 155355016) has the molecular formula C12H18F2O2 and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-(3,3-difluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-(3,3-difluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155355016 |
| Molecular Formula | C12H18F2O2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(3,3-difluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C12H18F2O2/c1-8(2)10(15)16-11(3,4)9-5-6-12(13,14)7-9/h9H,1,5-7H2,2-4H3 |
| InChIKey | JWUFMSHXSACFHD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|