C19H30O2 — CID 139934567
[4-(1-adamantyl)-2-methylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 139934567) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [4-(1-adamantyl)-2-methylbutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-(1-adamantyl)-2-methylbutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139934567 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [4-(1-adamantyl)-2-methylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H30O2/c1-13(2)17(20)21-18(3,4)5-6-19-10-14-7-15(11-19)9-16(8-14)12-19/h14-16H,1,5-12H2,2-4H3 |
| InChIKey | FIBLXFAQDAMZPP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|