About [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate
[3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate (PubChem CID 163877430) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate |
| PubChem CID | 163877430 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate |
| SMILES | C=C(N)C(=O)OC(C)(C)CCOC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H29NO4/c1-12(20)16(21)24-18(2,3)4-5-23-17(22)19-9-13-6-14(10-19)8-15(7-13)11-19/h13-15H,1,4-11,20H2,2-3H3 |
| InChIKey | PQDKOBTXAFGBFS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate?
The IUPAC name of [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate (CID 163877430) is [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate.
What is the SMILES notation for [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate?
The canonical SMILES for [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate is C=C(N)C(=O)OC(C)(C)CCOC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate?
The InChIKey is PQDKOBTXAFGBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO4/c1-12(20)16(21)24-18(2,3)4-5-23-17(22)19-9-13-6-14(10-19)8-15(7-13)11-19/h13-15H,1,4-11,20H2,2-3H3.
What are the key properties of [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate?
[3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate has a molecular weight of 335.44 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-aminoprop-2-enoyloxy)-3-methylbutyl] adamantane-1-carboxylate is sourced from PubChem (CID 163877430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).