C18H28O3 — CID 166475624
[1-(2-ethyl-1-adamantyl)-1-hydroxyethyl] 2-methylprop-2-enoate (PubChem CID 166475624) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [1-(2-ethyl-1-adamantyl)-1-hydroxyethyl] 2-methylprop-2-enoate.
| Compound Name | [1-(2-ethyl-1-adamantyl)-1-hydroxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166475624 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [1-(2-ethyl-1-adamantyl)-1-hydroxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(O)C12CC3CC(CC(C3)C1CC)C2 |
| InChI | InChI=1S/C18H28O3/c1-5-15-14-7-12-6-13(8-14)10-18(15,9-12)17(4,20)21-16(19)11(2)3/h12-15,20H,2,5-10H2,1,3-4H3 |
| InChIKey | MADIFZNVAJSIDL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|