C15H24O7 — CID 90854868
tert-butyl 3,4,5-trihydroxy-1-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 90854868) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is tert-butyl 3,4,5-trihydroxy-1-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 3,4,5-trihydroxy-1-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90854868 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl 3,4,5-trihydroxy-1-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1(C(=O)OC(C)(C)C)CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C15H24O7/c1-8(2)12(19)21-15(13(20)22-14(3,4)5)6-9(16)11(18)10(17)7-15/h9-11,16-18H,1,6-7H2,2-5H3 |
| InChIKey | PUPZRZSGBWEVNE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|