C17H22O6 — CID 139915879
tert-butyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-7-carboxylate (PubChem CID 139915879) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is tert-butyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-7-carboxylate |
|---|---|
| PubChem CID | 139915879 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-7-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3C(=O)OC1C3(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H22O6/c1-8(2)13(18)21-11-9-6-10-14(19)22-12(11)17(10,7-9)15(20)23-16(3,4)5/h9-12H,1,6-7H2,2-5H3 |
| InChIKey | LGUCBSORWPSZQF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|