C17H22O6 — CID 139924057
2-(5,8-dioxo-4,7-dioxatricyclo[4.4.1.13,9]dodecan-1-yl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 139924057) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-(5,8-dioxo-4,7-dioxatricyclo[4.4.1.13,9]dodecan-1-yl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-(5,8-dioxo-4,7-dioxatricyclo[4.4.1.13,9]dodecan-1-yl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139924057 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(5,8-dioxo-4,7-dioxatricyclo[4.4.1.13,9]dodecan-1-yl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C12CC3CC(C1)C(=O)OC(C2)C(=O)O3 |
| InChI | InChI=1S/C17H22O6/c1-9(2)13(18)23-16(3,4)17-6-10-5-11(7-17)21-15(20)12(8-17)22-14(10)19/h10-12H,1,5-8H2,2-4H3 |
| InChIKey | BAEXEGKMSXDIJY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|