C21H32O6 — CID 89116229
ditert-butyl 5-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 89116229) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is ditert-butyl 5-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | ditert-butyl 5-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 89116229 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | ditert-butyl 5-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C(C(=O)OC(C)(C)C)C2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O6/c1-11(2)17(22)25-14-10-12-9-13(14)16(19(24)27-21(6,7)8)15(12)18(23)26-20(3,4)5/h12-16H,1,9-10H2,2-8H3 |
| InChIKey | HDINPCHDZBAUKW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|