C14H19NO2 — CID 118204435
[(6R)-3-amino-8-tricyclo[5.2.1.02,6]dec-4-enyl] 2-methylprop-2-enoate (PubChem CID 118204435) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is [(6R)-3-amino-8-tricyclo[5.2.1.02,6]dec-4-enyl] 2-methylprop-2-enoate.
| Compound Name | [(6R)-3-amino-8-tricyclo[5.2.1.02,6]dec-4-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118204435 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(6R)-3-amino-8-tricyclo[5.2.1.02,6]dec-4-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1[C@@H]1C=CC(N)C21 |
| InChI | InChI=1S/C14H19NO2/c1-7(2)14(16)17-12-6-8-5-10(12)9-3-4-11(15)13(8)9/h3-4,8-13H,1,5-6,15H2,2H3/t8?,9-,10?,11?,12?,13?/m0/s1 |
| InChIKey | IEJJJMCKNBQPHL-KKFNGLHCSA-N |
| XLogP | 1.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|