C32H44O8 — CID 160519304
(4-acetyloxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate;(8-acetyloxy-3-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate (PubChem CID 160519304) has the molecular formula C32H44O8 and a molecular weight of 556.70 g/mol. Its IUPAC name is (4-acetyloxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate;(8-acetyloxy-3-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate.
| Compound Name | (4-acetyloxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate;(8-acetyloxy-3-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160519304 |
| Molecular Formula | C32H44O8 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (4-acetyloxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate;(8-acetyloxy-3-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1CC(OC(C)=O)CC21.C=C(C)C(=O)OC1CCC2C3CC(CC3OC(C)=O)C12 |
| InChI | InChI=1S/2C16H22O4/c1-8(2)16(18)20-15-5-10-4-14(15)13-7-11(6-12(10)13)19-9(3)17;1-8(2)16(18)20-13-5-4-11-12-6-10(15(11)13)7-14(12)19-9(3)17/h2*10-15H,1,4-7H2,2-3H3 |
| InChIKey | QUBIMDWMYBRRAW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|