C10H23NO5S — CID 66868010
hydrogen sulfate;1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol (PubChem CID 66868010) has the molecular formula C10H23NO5S and a molecular weight of 269.36 g/mol. Its IUPAC name is hydrogen sulfate;1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol.
| Compound Name | hydrogen sulfate;1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 66868010 |
| Molecular Formula | C10H23NO5S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | hydrogen sulfate;1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol |
| SMILES | C[NH+]1C(C)(C)CC(O)CC1(C)C.O=S(=O)([O-])O |
| InChI | InChI=1S/C10H21NO.H2O4S/c1-9(2)6-8(12)7-10(3,4)11(9)5;1-5(2,3)4/h8,12H,6-7H2,1-5H3;(H2,1,2,3,4) |
| InChIKey | UOWRZBNGZFDQHW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|