strontium hydrogen sulfate

H2O8S2Sr — CID 160697720

IUPACstrontium hydrogen sulfate
SMILESO=S(=O)([O-])O.O=S(=O)([O-])O.[Sr+2]
InChIInChI=1S/2H2O4S.Sr/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+2/p-2
InChIKeyRQFAWFOJXPRRBW-UHFFFAOYSA-L
MW281.76 g/mol
LogP-2.37
Rot. Bonds

About strontium hydrogen sulfate

strontium hydrogen sulfate (PubChem CID 160697720) has the molecular formula H2O8S2Sr and a molecular weight of 281.76 g/mol. Its IUPAC name is strontium hydrogen sulfate.

Molecular Properties

Compound Namestrontium hydrogen sulfate
PubChem CID160697720
Molecular FormulaH2O8S2Sr
Molecular Weight281.76 g/mol
Exact Mass281.82
IUPAC Namestrontium hydrogen sulfate
SMILESO=S(=O)([O-])O.O=S(=O)([O-])O.[Sr+2]
InChIInChI=1S/2H2O4S.Sr/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+2/p-2
InChIKeyRQFAWFOJXPRRBW-UHFFFAOYSA-L
XLogP-2.37
TPSA154.86 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.76
LogP ≤ 5-2.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze strontium hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

hydrogen sulfate;zirconium(4+)
CID 11213772
hydrogen sulfate;hydron;silver
CID 173307708
CID 20581843
CID 20581843
sodium;hydrogen peroxide;hydrogen sulfate
CID 159927283
azane;hydrogen sulfate;vanadium;sulfate
CID 171375501
disodium;hydrogen sulfate;hydroxide;hydrochloride
CID 158787681
sodium;azane;hydrogen sulfate;hydrochloride
CID 173374550
lithium;silver;sulfuric acid;sulfate
CID 158234411
copper;hydrogen sulfate;iron(2+);trichloride;hydrochloride
CID 175145855
(N H3)5 Co O2 Co (N H3)5 S O4 (H S O4)3
CID 139088979
copper;aminoazanide;hydrogen sulfate
CID 71432056
sodium;hydrogen sulfate;phosphorous acid
CID 160651784

Frequently Asked Questions

What is the IUPAC name of strontium hydrogen sulfate?
The IUPAC name of strontium hydrogen sulfate (CID 160697720) is strontium hydrogen sulfate.
What is the SMILES notation for strontium hydrogen sulfate?
The canonical SMILES for strontium hydrogen sulfate is O=S(=O)([O-])O.O=S(=O)([O-])O.[Sr+2].
What is the InChIKey of strontium hydrogen sulfate?
The InChIKey is RQFAWFOJXPRRBW-UHFFFAOYSA-L. The full InChI is InChI=1S/2H2O4S.Sr/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of strontium hydrogen sulfate?
strontium hydrogen sulfate has a molecular weight of 281.76 g/mol, XLogP of -2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for strontium hydrogen sulfate is sourced from PubChem (CID 160697720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).