About copper;aminoazanide;hydrogen sulfate
copper;aminoazanide;hydrogen sulfate (PubChem CID 71432056) has the molecular formula H4CuN2O4S
and a molecular weight of 191.66 g/mol. Its IUPAC name is copper;aminoazanide;hydrogen sulfate.
Molecular Properties
| Compound Name | copper;aminoazanide;hydrogen sulfate |
| PubChem CID | 71432056 |
| Molecular Formula | H4CuN2O4S |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 190.92 |
| IUPAC Name | copper;aminoazanide;hydrogen sulfate |
| SMILES | O=S(=O)([O-])O.[Cu+2].[NH-]N |
| InChI | InChI=1S/Cu.H3N2.H2O4S/c;1-2;1-5(2,3)4/h;1H,2H2;(H2,1,2,3,4)/q+2;-1;/p-1 |
| InChIKey | XXWOLLZLBOZJHF-UHFFFAOYSA-M |
| XLogP | -1.09 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze copper;aminoazanide;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;aminoazanide;hydrogen sulfate?
The IUPAC name of copper;aminoazanide;hydrogen sulfate (CID 71432056) is copper;aminoazanide;hydrogen sulfate.
What is the SMILES notation for copper;aminoazanide;hydrogen sulfate?
The canonical SMILES for copper;aminoazanide;hydrogen sulfate is O=S(=O)([O-])O.[Cu+2].[NH-]N.
What is the InChIKey of copper;aminoazanide;hydrogen sulfate?
The InChIKey is XXWOLLZLBOZJHF-UHFFFAOYSA-M. The full InChI is InChI=1S/Cu.H3N2.H2O4S/c;1-2;1-5(2,3)4/h;1H,2H2;(H2,1,2,3,4)/q+2;-1;/p-1.
What are the key properties of copper;aminoazanide;hydrogen sulfate?
copper;aminoazanide;hydrogen sulfate has a molecular weight of 191.66 g/mol, XLogP of -1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;aminoazanide;hydrogen sulfate is sourced from PubChem (CID 71432056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).