C2H9CuN2O4S — CID 23344051
copper(1+);ethane-1,2-diamine;hydrogen sulfate (PubChem CID 23344051) has the molecular formula C2H9CuN2O4S and a molecular weight of 220.72 g/mol. Its IUPAC name is copper(1+);ethane-1,2-diamine;hydrogen sulfate.
| Compound Name | copper(1+);ethane-1,2-diamine;hydrogen sulfate |
|---|---|
| PubChem CID | 23344051 |
| Molecular Formula | C2H9CuN2O4S |
| Molecular Weight | 220.72 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | copper(1+);ethane-1,2-diamine;hydrogen sulfate |
| SMILES | NCCN.O=S(=O)([O-])O.[Cu+] |
| InChI | InChI=1S/C2H8N2.Cu.H2O4S/c3-1-2-4;;1-5(2,3)4/h1-4H2;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | MZOOGAAYSMQJGZ-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.72 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|