About sodium;hydrogen sulfate;phosphorous acid
sodium;hydrogen sulfate;phosphorous acid (PubChem CID 160651784) has the molecular formula H4NaO7PS
and a molecular weight of 202.06 g/mol. Its IUPAC name is sodium;hydrogen sulfate;phosphorous acid.
Molecular Properties
| Compound Name | sodium;hydrogen sulfate;phosphorous acid |
| PubChem CID | 160651784 |
| Molecular Formula | H4NaO7PS |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 201.93 |
| IUPAC Name | sodium;hydrogen sulfate;phosphorous acid |
| SMILES | O=S(=O)([O-])O.OP(O)O.[Na+] |
| InChI | InChI=1S/Na.H2O4S.H3O3P/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);1-3H/q+1;;/p-1 |
| InChIKey | RKNDRUCHRMEGBU-UHFFFAOYSA-M |
| XLogP | -4.80 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydrogen sulfate;phosphorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen sulfate;phosphorous acid?
The IUPAC name of sodium;hydrogen sulfate;phosphorous acid (CID 160651784) is sodium;hydrogen sulfate;phosphorous acid.
What is the SMILES notation for sodium;hydrogen sulfate;phosphorous acid?
The canonical SMILES for sodium;hydrogen sulfate;phosphorous acid is O=S(=O)([O-])O.OP(O)O.[Na+].
What is the InChIKey of sodium;hydrogen sulfate;phosphorous acid?
The InChIKey is RKNDRUCHRMEGBU-UHFFFAOYSA-M. The full InChI is InChI=1S/Na.H2O4S.H3O3P/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);1-3H/q+1;;/p-1.
What are the key properties of sodium;hydrogen sulfate;phosphorous acid?
sodium;hydrogen sulfate;phosphorous acid has a molecular weight of 202.06 g/mol, XLogP of -4.80, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen sulfate;phosphorous acid is sourced from PubChem (CID 160651784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).