About sodium;hydrogen sulfate;nitrous acid
sodium;hydrogen sulfate;nitrous acid (PubChem CID 173241300) has the molecular formula H2NNaO6S
and a molecular weight of 167.07 g/mol. Its IUPAC name is sodium;hydrogen sulfate;nitrous acid.
Molecular Properties
| Compound Name | sodium;hydrogen sulfate;nitrous acid |
| PubChem CID | 173241300 |
| Molecular Formula | H2NNaO6S |
| Molecular Weight | 167.07 g/mol |
| Exact Mass | 166.95 |
| IUPAC Name | sodium;hydrogen sulfate;nitrous acid |
| SMILES | O=NO.O=S(=O)([O-])O.[Na+] |
| InChI | InChI=1S/HNO2.Na.H2O4S/c2-1-3;;1-5(2,3)4/h(H,2,3);;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | QDPQGFCZJZJQQC-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.07 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydrogen sulfate;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen sulfate;nitrous acid?
The IUPAC name of sodium;hydrogen sulfate;nitrous acid (CID 173241300) is sodium;hydrogen sulfate;nitrous acid.
What is the SMILES notation for sodium;hydrogen sulfate;nitrous acid?
The canonical SMILES for sodium;hydrogen sulfate;nitrous acid is O=NO.O=S(=O)([O-])O.[Na+].
What is the InChIKey of sodium;hydrogen sulfate;nitrous acid?
The InChIKey is QDPQGFCZJZJQQC-UHFFFAOYSA-M. The full InChI is InChI=1S/HNO2.Na.H2O4S/c2-1-3;;1-5(2,3)4/h(H,2,3);;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;hydrogen sulfate;nitrous acid?
sodium;hydrogen sulfate;nitrous acid has a molecular weight of 167.07 g/mol, XLogP of -3.85, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen sulfate;nitrous acid is sourced from PubChem (CID 173241300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).