About hydrogen sulfate;trimethylstannanylium
hydrogen sulfate;trimethylstannanylium (PubChem CID 18317158) has the molecular formula C3H10O4SSn
and a molecular weight of 260.89 g/mol. Its IUPAC name is hydrogen sulfate;trimethylstannanylium.
Molecular Properties
| Compound Name | hydrogen sulfate;trimethylstannanylium |
| PubChem CID | 18317158 |
| Molecular Formula | C3H10O4SSn |
| Molecular Weight | 260.89 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | hydrogen sulfate;trimethylstannanylium |
| SMILES | C[Sn+](C)C.O=S(=O)([O-])O |
| InChI | InChI=1S/3CH3.H2O4S.Sn/c;;;1-5(2,3)4;/h3*1H3;(H2,1,2,3,4);/q;;;;+1/p-1 |
| InChIKey | NUMBJEPDYGRUNB-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.89 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfate;trimethylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfate;trimethylstannanylium?
The IUPAC name of hydrogen sulfate;trimethylstannanylium (CID 18317158) is hydrogen sulfate;trimethylstannanylium.
What is the SMILES notation for hydrogen sulfate;trimethylstannanylium?
The canonical SMILES for hydrogen sulfate;trimethylstannanylium is C[Sn+](C)C.O=S(=O)([O-])O.
What is the InChIKey of hydrogen sulfate;trimethylstannanylium?
The InChIKey is NUMBJEPDYGRUNB-UHFFFAOYSA-M. The full InChI is InChI=1S/3CH3.H2O4S.Sn/c;;;1-5(2,3)4;/h3*1H3;(H2,1,2,3,4);/q;;;;+1/p-1.
What are the key properties of hydrogen sulfate;trimethylstannanylium?
hydrogen sulfate;trimethylstannanylium has a molecular weight of 260.89 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;trimethylstannanylium is sourced from PubChem (CID 18317158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).