About hydrogen sulfate;trimethylsulfanium
hydrogen sulfate;trimethylsulfanium (PubChem CID 10942955) has the molecular formula C3H10O4S2
and a molecular weight of 174.24 g/mol. Its IUPAC name is hydrogen sulfate;trimethylsulfanium.
Molecular Properties
| Compound Name | hydrogen sulfate;trimethylsulfanium |
| PubChem CID | 10942955 |
| Molecular Formula | C3H10O4S2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | hydrogen sulfate;trimethylsulfanium |
| SMILES | C[S+](C)C.O=S(=O)([O-])O |
| InChI | InChI=1S/C3H9S.H2O4S/c1-4(2)3;1-5(2,3)4/h1-3H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | ALALNHBRSNEZAC-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfate;trimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfate;trimethylsulfanium?
The IUPAC name of hydrogen sulfate;trimethylsulfanium (CID 10942955) is hydrogen sulfate;trimethylsulfanium.
What is the SMILES notation for hydrogen sulfate;trimethylsulfanium?
The canonical SMILES for hydrogen sulfate;trimethylsulfanium is C[S+](C)C.O=S(=O)([O-])O.
What is the InChIKey of hydrogen sulfate;trimethylsulfanium?
The InChIKey is ALALNHBRSNEZAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9S.H2O4S/c1-4(2)3;1-5(2,3)4/h1-3H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of hydrogen sulfate;trimethylsulfanium?
hydrogen sulfate;trimethylsulfanium has a molecular weight of 174.24 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;trimethylsulfanium is sourced from PubChem (CID 10942955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).