C10H18NNaOS2 — CID 71677643
sodium 4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carbodithioate (PubChem CID 71677643) has the molecular formula C10H18NNaOS2 and a molecular weight of 255.38 g/mol. Its IUPAC name is sodium 4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carbodithioate.
| Compound Name | sodium 4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 71677643 |
| Molecular Formula | C10H18NNaOS2 |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | sodium 4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carbodithioate |
| SMILES | CC1(C)CC(O)CC(C)(C)N1C(=S)[S-].[Na+] |
| InChI | InChI=1S/C10H19NOS2.Na/c1-9(2)5-7(12)6-10(3,4)11(9)8(13)14;/h7,12H,5-6H2,1-4H3,(H,13,14);/q;+1/p-1 |
| InChIKey | PMALGVVISRVZEE-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|