C24H50N4O2 — CID 139605403
1-[6-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 139605403) has the molecular formula C24H50N4O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1-[6-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[6-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 139605403 |
| Molecular Formula | C24H50N4O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 1-[6-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1NCCCCCCNN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C24H50N4O2/c1-21(2)15-19(29)16-22(3,4)27(21)25-13-11-9-10-12-14-26-28-23(5,6)17-20(30)18-24(28,7)8/h19-20,25-26,29-30H,9-18H2,1-8H3 |
| InChIKey | PDRZTVWXKQYCKU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|