C19H40N4 — CID 175318158
N-hexyl-2,2,6,6-tetramethyl-4-piperazin-1-ylpiperidin-1-amine (PubChem CID 175318158) has the molecular formula C19H40N4 and a molecular weight of 324.56 g/mol. Its IUPAC name is N-hexyl-2,2,6,6-tetramethyl-4-piperazin-1-ylpiperidin-1-amine.
| Compound Name | N-hexyl-2,2,6,6-tetramethyl-4-piperazin-1-ylpiperidin-1-amine |
|---|---|
| PubChem CID | 175318158 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | N-hexyl-2,2,6,6-tetramethyl-4-piperazin-1-ylpiperidin-1-amine |
| SMILES | CCCCCCNN1C(C)(C)CC(N2CCNCC2)CC1(C)C |
| InChI | InChI=1S/C19H40N4/c1-6-7-8-9-10-21-23-18(2,3)15-17(16-19(23,4)5)22-13-11-20-12-14-22/h17,20-21H,6-16H2,1-5H3 |
| InChIKey | BZVUFRBDDWFNBP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|