C8H14F2N2 — CID 126739503
1-(3,3-difluorocyclobutyl)piperazine (PubChem CID 126739503) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)piperazine.
| Compound Name | 1-(3,3-difluorocyclobutyl)piperazine |
|---|---|
| PubChem CID | 126739503 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)piperazine |
| SMILES | FC1(F)CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C8H14F2N2/c9-8(10)5-7(6-8)12-3-1-11-2-4-12/h7,11H,1-6H2 |
| InChIKey | XSZMGPVGSMJLNN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |