C11H19F2N3 — CID 146013256
1-(azetidin-3-yl)-4-(3,3-difluorocyclobutyl)piperazine (PubChem CID 146013256) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(3,3-difluorocyclobutyl)piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-(3,3-difluorocyclobutyl)piperazine |
|---|---|
| PubChem CID | 146013256 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(3,3-difluorocyclobutyl)piperazine |
| SMILES | FC1(F)CC(N2CCN(C3CNC3)CC2)C1 |
| InChI | InChI=1S/C11H19F2N3/c12-11(13)5-9(6-11)15-1-3-16(4-2-15)10-7-14-8-10/h9-10,14H,1-8H2 |
| InChIKey | ZNOGIOZOXXHTIO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |