C3H8N2O2 — CID 174366808
(3,3-diaminooxiran-2-yl)methanol (PubChem CID 174366808) has the molecular formula C3H8N2O2 and a molecular weight of 104.11 g/mol. Its IUPAC name is (3,3-diaminooxiran-2-yl)methanol.
| Compound Name | (3,3-diaminooxiran-2-yl)methanol |
|---|---|
| PubChem CID | 174366808 |
| Molecular Formula | C3H8N2O2 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | (3,3-diaminooxiran-2-yl)methanol |
| SMILES | NC1(N)OC1CO |
| InChI | InChI=1S/C3H8N2O2/c4-3(5)2(1-6)7-3/h2,6H,1,4-5H2 |
| InChIKey | VHBPVKKSSYMYDZ-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 84.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|