C7H15NO3 — CID 137455676
4-amino-2-(hydroxymethyl)-5,5-dimethyloxolan-3-ol (PubChem CID 137455676) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is 4-amino-2-(hydroxymethyl)-5,5-dimethyloxolan-3-ol.
| Compound Name | 4-amino-2-(hydroxymethyl)-5,5-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 137455676 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 4-amino-2-(hydroxymethyl)-5,5-dimethyloxolan-3-ol |
| SMILES | CC1(C)OC(CO)C(O)C1N |
| InChI | InChI=1S/C7H15NO3/c1-7(2)6(8)5(10)4(3-9)11-7/h4-6,9-10H,3,8H2,1-2H3 |
| InChIKey | AJNNKOKVEALWMG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |