C11H21NO6 — CID 141416489
1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 141416489) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 141416489 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-[(3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C11H21NO6/c1-10(2,3)9(16)11(17)8(12)7(15)6(14)5(4-13)18-11/h5-8,13-15,17H,4,12H2,1-3H3/t5-,6-,7+,8-,11?/m1/s1 |
| InChIKey | JGKYRPNAWQLKCA-FKCQWBASSA-N |
| XLogP | -2.27 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |