C11H21NO7 — CID 131739857
tert-butyl (3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 131739857) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is tert-butyl (3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | tert-butyl (3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 131739857 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | tert-butyl (3R,4R,5S,6R)-3-amino-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C11H21NO7/c1-10(2,3)19-9(16)11(17)8(12)7(15)6(14)5(4-13)18-11/h5-8,13-15,17H,4,12H2,1-3H3/t5-,6-,7+,8-,11?/m1/s1 |
| InChIKey | UMORSOFBADGEFA-FKCQWBASSA-N |
| XLogP | -2.54 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |